C22H32N2O3S — CID 174532790
2-[[4-(4-methylphenyl)piperidin-1-yl]sulfonylmethyl]non-3-ynamide (PubChem CID 174532790) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)piperidin-1-yl]sulfonylmethyl]non-3-ynamide.
| Compound Name | 2-[[4-(4-methylphenyl)piperidin-1-yl]sulfonylmethyl]non-3-ynamide |
|---|---|
| PubChem CID | 174532790 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[[4-(4-methylphenyl)piperidin-1-yl]sulfonylmethyl]non-3-ynamide |
| SMILES | CCCCCC#CC(CS(=O)(=O)N1CCC(c2ccc(C)cc2)CC1)C(N)=O |
| InChI | InChI=1S/C22H32N2O3S/c1-3-4-5-6-7-8-21(22(23)25)17-28(26,27)24-15-13-20(14-16-24)19-11-9-18(2)10-12-19/h9-12,20-21H,3-6,13-17H2,1-2H3,(H2,23,25) |
| InChIKey | SMWDUUXQACAWET-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|