C22H32N2O4S — CID 142781546
2-hydroxy-2-[[4-(4-methylphenyl)piperidin-1-yl]sulfonylmethyl]non-3-ynamide (PubChem CID 142781546) has the molecular formula C22H32N2O4S and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-hydroxy-2-[[4-(4-methylphenyl)piperidin-1-yl]sulfonylmethyl]non-3-ynamide.
| Compound Name | 2-hydroxy-2-[[4-(4-methylphenyl)piperidin-1-yl]sulfonylmethyl]non-3-ynamide |
|---|---|
| PubChem CID | 142781546 |
| Molecular Formula | C22H32N2O4S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2-hydroxy-2-[[4-(4-methylphenyl)piperidin-1-yl]sulfonylmethyl]non-3-ynamide |
| SMILES | CCCCCC#CC(O)(CS(=O)(=O)N1CCC(c2ccc(C)cc2)CC1)C(N)=O |
| InChI | InChI=1S/C22H32N2O4S/c1-3-4-5-6-7-14-22(26,21(23)25)17-29(27,28)24-15-12-20(13-16-24)19-10-8-18(2)9-11-19/h8-11,20,26H,3-6,12-13,15-17H2,1-2H3,(H2,23,25) |
| InChIKey | LUAMGRYNTKMLPQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|