C18H26FN3O4SSi — CID 142781551
2-amino-2-[[4-(4-fluorophenyl)piperazin-1-yl]sulfonylmethyl]-4-trimethylsilylbut-3-ynoic acid (PubChem CID 142781551) has the molecular formula C18H26FN3O4SSi and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-amino-2-[[4-(4-fluorophenyl)piperazin-1-yl]sulfonylmethyl]-4-trimethylsilylbut-3-ynoic acid.
| Compound Name | 2-amino-2-[[4-(4-fluorophenyl)piperazin-1-yl]sulfonylmethyl]-4-trimethylsilylbut-3-ynoic acid |
|---|---|
| PubChem CID | 142781551 |
| Molecular Formula | C18H26FN3O4SSi |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-amino-2-[[4-(4-fluorophenyl)piperazin-1-yl]sulfonylmethyl]-4-trimethylsilylbut-3-ynoic acid |
| SMILES | C[Si](C)(C)C#CC(N)(CS(=O)(=O)N1CCN(c2ccc(F)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C18H26FN3O4SSi/c1-28(2,3)13-8-18(20,17(23)24)14-27(25,26)22-11-9-21(10-12-22)16-6-4-15(19)5-7-16/h4-7H,9-12,14,20H2,1-3H3,(H,23,24) |
| InChIKey | YUQXIPMEPKANGP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|