C22H25N3O2 — CID 95725760
(2S)-N-cyclopropyl-1-(2,2-diphenylacetyl)piperazine-2-carboxamide (PubChem CID 95725760) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-1-(2,2-diphenylacetyl)piperazine-2-carboxamide.
| Compound Name | (2S)-N-cyclopropyl-1-(2,2-diphenylacetyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 95725760 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (2S)-N-cyclopropyl-1-(2,2-diphenylacetyl)piperazine-2-carboxamide |
| SMILES | O=C(NC1CC1)[C@@H]1CNCCN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O2/c26-21(24-18-11-12-18)19-15-23-13-14-25(19)22(27)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18-20,23H,11-15H2,(H,24,26)/t19-/m0/s1 |
| InChIKey | NEZCAOORHSGSEA-IBGZPJMESA-N |
| XLogP | 1.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |