C14H20ClN5O2 — CID 95707096
(2R)-1-[3-(4-chloropyrazol-1-yl)propanoyl]-N-cyclopropylpiperazine-2-carboxamide (PubChem CID 95707096) has the molecular formula C14H20ClN5O2 and a molecular weight of 325.80 g/mol. Its IUPAC name is (2R)-1-[3-(4-chloropyrazol-1-yl)propanoyl]-N-cyclopropylpiperazine-2-carboxamide.
| Compound Name | (2R)-1-[3-(4-chloropyrazol-1-yl)propanoyl]-N-cyclopropylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 95707096 |
| Molecular Formula | C14H20ClN5O2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (2R)-1-[3-(4-chloropyrazol-1-yl)propanoyl]-N-cyclopropylpiperazine-2-carboxamide |
| SMILES | O=C(NC1CC1)[C@H]1CNCCN1C(=O)CCn1cc(Cl)cn1 |
| InChI | InChI=1S/C14H20ClN5O2/c15-10-7-17-19(9-10)5-3-13(21)20-6-4-16-8-12(20)14(22)18-11-1-2-11/h7,9,11-12,16H,1-6,8H2,(H,18,22)/t12-/m1/s1 |
| InChIKey | JCRSBLHALNGLML-GFCCVEGCSA-N |
| XLogP | 0.01 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |