C30H30FNO5 — CID 57273539
dibenzyl 4-[3-(4-fluorophenyl)-3-oxopropyl]piperidine-1,2-dicarboxylate (PubChem CID 57273539) has the molecular formula C30H30FNO5 and a molecular weight of 503.57 g/mol. Its IUPAC name is dibenzyl 4-[3-(4-fluorophenyl)-3-oxopropyl]piperidine-1,2-dicarboxylate.
| Compound Name | dibenzyl 4-[3-(4-fluorophenyl)-3-oxopropyl]piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57273539 |
| Molecular Formula | C30H30FNO5 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | dibenzyl 4-[3-(4-fluorophenyl)-3-oxopropyl]piperidine-1,2-dicarboxylate |
| SMILES | O=C(CCC1CCN(C(=O)OCc2ccccc2)C(C(=O)OCc2ccccc2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H30FNO5/c31-26-14-12-25(13-15-26)28(33)16-11-22-17-18-32(30(35)37-21-24-9-5-2-6-10-24)27(19-22)29(34)36-20-23-7-3-1-4-8-23/h1-10,12-15,22,27H,11,16-21H2 |
| InChIKey | DKBHPGRMLSSBJA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |