C16H22NO7P — CID 54540544
(2-methoxycarbonyl-1-phenylmethoxycarbonylpiperidin-4-yl)methylphosphonic acid (PubChem CID 54540544) has the molecular formula C16H22NO7P and a molecular weight of 371.33 g/mol. Its IUPAC name is (2-methoxycarbonyl-1-phenylmethoxycarbonylpiperidin-4-yl)methylphosphonic acid.
| Compound Name | (2-methoxycarbonyl-1-phenylmethoxycarbonylpiperidin-4-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 54540544 |
| Molecular Formula | C16H22NO7P |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (2-methoxycarbonyl-1-phenylmethoxycarbonylpiperidin-4-yl)methylphosphonic acid |
| SMILES | COC(=O)C1CC(CP(=O)(O)O)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H22NO7P/c1-23-15(18)14-9-13(11-25(20,21)22)7-8-17(14)16(19)24-10-12-5-3-2-4-6-12/h2-6,13-14H,7-11H2,1H3,(H2,20,21,22) |
| InChIKey | ZCWKGTIZZZLDSW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|