C16H21NO4 — CID 135393323
1-O-benzyl 4-O-methyl (2R)-2-methylpiperidine-1,4-dicarboxylate (PubChem CID 135393323) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-O-benzyl 4-O-methyl (2R)-2-methylpiperidine-1,4-dicarboxylate.
| Compound Name | 1-O-benzyl 4-O-methyl (2R)-2-methylpiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 135393323 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-O-benzyl 4-O-methyl (2R)-2-methylpiperidine-1,4-dicarboxylate |
| SMILES | COC(=O)C1CCN(C(=O)OCc2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C16H21NO4/c1-12-10-14(15(18)20-2)8-9-17(12)16(19)21-11-13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3/t12-,14?/m1/s1 |
| InChIKey | AVJWMDCTKNYGAV-PUODRLBUSA-N |
| XLogP | 2.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |