C17H23NO4 — CID 67044013
1-O-benzyl 3-O-methyl 6-ethylpiperidine-1,3-dicarboxylate (PubChem CID 67044013) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl 6-ethylpiperidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl 6-ethylpiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 67044013 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1-O-benzyl 3-O-methyl 6-ethylpiperidine-1,3-dicarboxylate |
| SMILES | CCC1CCC(C(=O)OC)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-3-15-10-9-14(16(19)21-2)11-18(15)17(20)22-12-13-7-5-4-6-8-13/h4-8,14-15H,3,9-12H2,1-2H3 |
| InChIKey | IETZARFDVQEFSD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |