C16H19NO5 — CID 90283225
1-O-benzyl 3-O-methyl 6-formylpiperidine-1,3-dicarboxylate (PubChem CID 90283225) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl 6-formylpiperidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl 6-formylpiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 90283225 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-O-benzyl 3-O-methyl 6-formylpiperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1CCC(C=O)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H19NO5/c1-21-15(19)13-7-8-14(10-18)17(9-13)16(20)22-11-12-5-3-2-4-6-12/h2-6,10,13-14H,7-9,11H2,1H3 |
| InChIKey | KKAPXUHIRQHHDW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|