C27H26FN3O5 — CID 151647759
dibenzyl 4-[(4-fluorobenzoyl)amino]piperazine-1,3-dicarboxylate (PubChem CID 151647759) has the molecular formula C27H26FN3O5 and a molecular weight of 491.52 g/mol. Its IUPAC name is dibenzyl 4-[(4-fluorobenzoyl)amino]piperazine-1,3-dicarboxylate.
| Compound Name | dibenzyl 4-[(4-fluorobenzoyl)amino]piperazine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 151647759 |
| Molecular Formula | C27H26FN3O5 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | dibenzyl 4-[(4-fluorobenzoyl)amino]piperazine-1,3-dicarboxylate |
| SMILES | O=C(NN1CCN(C(=O)OCc2ccccc2)CC1C(=O)OCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H26FN3O5/c28-23-13-11-22(12-14-23)25(32)29-31-16-15-30(27(34)36-19-21-9-5-2-6-10-21)17-24(31)26(33)35-18-20-7-3-1-4-8-20/h1-14,24H,15-19H2,(H,29,32) |
| InChIKey | QTWGMZUAFOQIGQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |