C20H21FN2O4 — CID 51440397
(2R)-1-[(4-fluorophenyl)methyl]-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid (PubChem CID 51440397) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is (2R)-1-[(4-fluorophenyl)methyl]-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid.
| Compound Name | (2R)-1-[(4-fluorophenyl)methyl]-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 51440397 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (2R)-1-[(4-fluorophenyl)methyl]-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C(=O)OCc2ccccc2)CCN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN2O4/c21-17-8-6-15(7-9-17)12-22-10-11-23(13-18(22)19(24)25)20(26)27-14-16-4-2-1-3-5-16/h1-9,18H,10-14H2,(H,24,25)/t18-/m1/s1 |
| InChIKey | YJFFAHBVQYUJFU-GOSISDBHSA-N |
| XLogP | 2.73 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |