C13H16N2O4 — CID 142773332
4-benzylpiperazine-1,3-dicarboxylic acid (PubChem CID 142773332) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-benzylpiperazine-1,3-dicarboxylic acid.
| Compound Name | 4-benzylpiperazine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 142773332 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-benzylpiperazine-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)O)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H16N2O4/c16-12(17)11-9-15(13(18)19)7-6-14(11)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,16,17)(H,18,19) |
| InChIKey | PCGGNMVODYCIPP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |