C16H21N3O6 — CID 170157322
4-[2-(phenylmethoxycarbonylamino)ethyl]piperazine-1,3-dicarboxylic acid (PubChem CID 170157322) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is 4-[2-(phenylmethoxycarbonylamino)ethyl]piperazine-1,3-dicarboxylic acid.
| Compound Name | 4-[2-(phenylmethoxycarbonylamino)ethyl]piperazine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 170157322 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 4-[2-(phenylmethoxycarbonylamino)ethyl]piperazine-1,3-dicarboxylic acid |
| SMILES | O=C(NCCN1CCN(C(=O)O)CC1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21N3O6/c20-14(21)13-10-19(16(23)24)9-8-18(13)7-6-17-15(22)25-11-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H,17,22)(H,20,21)(H,23,24) |
| InChIKey | OBAGAZICNOJOEJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |