C15H18N2O3 — CID 175210645
1-benzyl-3-oxo-2,3a,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine-6-carboxylic acid (PubChem CID 175210645) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-benzyl-3-oxo-2,3a,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine-6-carboxylic acid.
| Compound Name | 1-benzyl-3-oxo-2,3a,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 175210645 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-benzyl-3-oxo-2,3a,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine-6-carboxylic acid |
| SMILES | O=C1CN(Cc2ccccc2)C2CN(C(=O)O)CCC12 |
| InChI | InChI=1S/C15H18N2O3/c18-14-10-17(8-11-4-2-1-3-5-11)13-9-16(15(19)20)7-6-12(13)14/h1-5,12-13H,6-10H2,(H,19,20) |
| InChIKey | WRTBTBWIXMTFEG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |