C22H26N2O4 — CID 175879442
(2R,4S)-4-(dibenzylamino)-1-methoxycarbonylpiperidine-2-carboxylic acid (PubChem CID 175879442) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2R,4S)-4-(dibenzylamino)-1-methoxycarbonylpiperidine-2-carboxylic acid.
| Compound Name | (2R,4S)-4-(dibenzylamino)-1-methoxycarbonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175879442 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (2R,4S)-4-(dibenzylamino)-1-methoxycarbonylpiperidine-2-carboxylic acid |
| SMILES | COC(=O)N1CC[C@H](N(Cc2ccccc2)Cc2ccccc2)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C22H26N2O4/c1-28-22(27)24-13-12-19(14-20(24)21(25)26)23(15-17-8-4-2-5-9-17)16-18-10-6-3-7-11-18/h2-11,19-20H,12-16H2,1H3,(H,25,26)/t19-,20+/m0/s1 |
| InChIKey | CRCJTVIPUASQBR-VQTJNVASSA-N |
| XLogP | 3.37 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |