C20H23NO2 — CID 67068353
3-(dibenzylamino)cyclopentane-1-carboxylic acid (PubChem CID 67068353) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-(dibenzylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(dibenzylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 67068353 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3-(dibenzylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(N(Cc2ccccc2)Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H23NO2/c22-20(23)18-11-12-19(13-18)21(14-16-7-3-1-4-8-16)15-17-9-5-2-6-10-17/h1-10,18-19H,11-15H2,(H,22,23) |
| InChIKey | UQSQJEOYKAOPQZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |