C22H27F2NO3 — CID 168976182
(2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-6,6-difluoro-2-hydroxyheptanoic acid (PubChem CID 168976182) has the molecular formula C22H27F2NO3 and a molecular weight of 391.46 g/mol. Its IUPAC name is (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-6,6-difluoro-2-hydroxyheptanoic acid.
| Compound Name | (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-6,6-difluoro-2-hydroxyheptanoic acid |
|---|---|
| PubChem CID | 168976182 |
| Molecular Formula | C22H27F2NO3 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (2S,3S)-3-[benzyl-[(1S)-1-phenylethyl]amino]-6,6-difluoro-2-hydroxyheptanoic acid |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)[C@@H](CCC(C)(F)F)[C@H](O)C(=O)O |
| InChI | InChI=1S/C22H27F2NO3/c1-16(18-11-7-4-8-12-18)25(15-17-9-5-3-6-10-17)19(20(26)21(27)28)13-14-22(2,23)24/h3-12,16,19-20,26H,13-15H2,1-2H3,(H,27,28)/t16-,19-,20-/m0/s1 |
| InChIKey | XGPAOZMPHOAXKJ-VDGAXYAQSA-N |
| XLogP | 4.50 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |