C26H35NO4 — CID 71615397
tert-butyl (E,2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2,7-dihydroxyhept-4-enoate (PubChem CID 71615397) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is tert-butyl (E,2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2,7-dihydroxyhept-4-enoate.
| Compound Name | tert-butyl (E,2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2,7-dihydroxyhept-4-enoate |
|---|---|
| PubChem CID | 71615397 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | tert-butyl (E,2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2,7-dihydroxyhept-4-enoate |
| SMILES | C[C@H](c1ccccc1)N(Cc1ccccc1)[C@H](/C=C/CCO)[C@@H](O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H35NO4/c1-20(22-15-9-6-10-16-22)27(19-21-13-7-5-8-14-21)23(17-11-12-18-28)24(29)25(30)31-26(2,3)4/h5-11,13-17,20,23-24,28-29H,12,18-19H2,1-4H3/b17-11+/t20-,23-,24-/m1/s1 |
| InChIKey | SDQLSNSXRAPQOB-RXMHYHKTSA-N |
| XLogP | 4.26 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|