C29H42FNO7 — CID 138695566
2-[2-[2-[2-[2-[4-(dibenzylamino)-3-fluorobutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 138695566) has the molecular formula C29H42FNO7 and a molecular weight of 535.65 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[4-(dibenzylamino)-3-fluorobutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 2-[2-[2-[2-[2-[4-(dibenzylamino)-3-fluorobutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 138695566 |
| Molecular Formula | C29H42FNO7 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 2-[2-[2-[2-[2-[4-(dibenzylamino)-3-fluorobutan-2-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | CC(OCCOCCOCCOCCOC(C)C(F)CN(Cc1ccccc1)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H42FNO7/c1-24(37-19-17-35-15-13-34-14-16-36-18-20-38-25(2)29(32)33)28(30)23-31(21-26-9-5-3-6-10-26)22-27-11-7-4-8-12-27/h3-12,24-25,28H,13-23H2,1-2H3,(H,32,33) |
| InChIKey | RPHDMYLZWKCXSE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|