C20H31NO3 — CID 10640412
(3aS,4R,5R,6R,6aR)-5-benzyl-4-(2,2-dimethylpropyl)-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium (PubChem CID 10640412) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is (3aS,4R,5R,6R,6aR)-5-benzyl-4-(2,2-dimethylpropyl)-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium.
| Compound Name | (3aS,4R,5R,6R,6aR)-5-benzyl-4-(2,2-dimethylpropyl)-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 10640412 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | (3aS,4R,5R,6R,6aR)-5-benzyl-4-(2,2-dimethylpropyl)-2,2,6-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
| SMILES | C[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@@H](CC(C)(C)C)[N@@+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C20H31NO3/c1-14-17-18(24-20(5,6)23-17)16(12-19(2,3)4)21(14,22)13-15-10-8-7-9-11-15/h7-11,14,16-18H,12-13H2,1-6H3/t14-,16-,17-,18+,21-/m1/s1 |
| InChIKey | HKEIWQGJSVYAFS-JYTGUGRZSA-N |
| XLogP | 4.23 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|