C32H45NO6 — CID 138973078
tert-butyl 3-[benzyl-[(1S)-1-phenylethyl]amino]-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 138973078) has the molecular formula C32H45NO6 and a molecular weight of 539.71 g/mol. Its IUPAC name is tert-butyl 3-[benzyl-[(1S)-1-phenylethyl]amino]-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | tert-butyl 3-[benzyl-[(1S)-1-phenylethyl]amino]-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 138973078 |
| Molecular Formula | C32H45NO6 |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | tert-butyl 3-[benzyl-[(1S)-1-phenylethyl]amino]-3-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)C(CC(=O)OC(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C32H45NO6/c1-22(24-17-13-10-14-18-24)33(20-23-15-11-9-12-16-23)25(19-27(34)37-30(2,3)4)28-29(39-32(7,8)38-28)26-21-35-31(5,6)36-26/h9-18,22,25-26,28-29H,19-21H2,1-8H3/t22-,25?,26+,28+,29+/m0/s1 |
| InChIKey | GUQCNJAQPWGTES-IWFIDCAFSA-N |
| XLogP | 6.02 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |