C39H64N2O7 — CID 6478712
ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl-[(Z)-octadec-9-enyl]amino]propanoate (PubChem CID 6478712) has the molecular formula C39H64N2O7 and a molecular weight of 672.95 g/mol. Its IUPAC name is ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl-[(Z)-octadec-9-enyl]amino]propanoate.
| Compound Name | ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl-[(Z)-octadec-9-enyl]amino]propanoate |
|---|---|
| PubChem CID | 6478712 |
| Molecular Formula | C39H64N2O7 |
| Molecular Weight | 672.95 g/mol |
| Exact Mass | 672.47 |
| IUPAC Name | ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl-[(Z)-octadec-9-enyl]amino]propanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(C(=O)NCc1ccccc1)[C@@H](CC(=O)OCC)C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C39H64N2O7/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-28-41(38(43)40-30-31-26-23-22-24-27-31)32(29-33(42)45-7-2)34-35(44-5)36-37(46-34)48-39(3,4)47-36/h14-15,22-24,26-27,32,34-37H,6-13,16-21,25,28-30H2,1-5H3,(H,40,43)/b15-14-/t32-,34?,35-,36+,37+/m0/s1 |
| InChIKey | ZDQZYVQRIJMATL-QBSIFUDLSA-N |
| XLogP | 8.45 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.95 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|