C30H36N2O8 — CID 508351
ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(3-acetylphenyl)carbamoyl-cyclopropylamino]propanoate (PubChem CID 508351) has the molecular formula C30H36N2O8 and a molecular weight of 552.62 g/mol. Its IUPAC name is ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(3-acetylphenyl)carbamoyl-cyclopropylamino]propanoate.
| Compound Name | ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(3-acetylphenyl)carbamoyl-cyclopropylamino]propanoate |
|---|---|
| PubChem CID | 508351 |
| Molecular Formula | C30H36N2O8 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(3-acetylphenyl)carbamoyl-cyclopropylamino]propanoate |
| SMILES | CCOC(=O)C[C@@H](C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1Oc1ccccc1)N(C(=O)Nc1cccc(C(C)=O)c1)C1CC1 |
| InChI | InChI=1S/C30H36N2O8/c1-5-36-24(34)17-23(32(21-14-15-21)29(35)31-20-11-9-10-19(16-20)18(2)33)25-26(37-22-12-7-6-8-13-22)27-28(38-25)40-30(3,4)39-27/h6-13,16,21,23,25-28H,5,14-15,17H2,1-4H3,(H,31,35)/t23-,25?,26-,27+,28+/m0/s1 |
| InChIKey | ZLDYXPFQZSAOIQ-OZVDCRRUSA-N |
| XLogP | 4.53 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |