C20H27ClN2O7 — CID 22211098
ethyl 3-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoylamino]propanoate (PubChem CID 22211098) has the molecular formula C20H27ClN2O7 and a molecular weight of 442.90 g/mol. Its IUPAC name is ethyl 3-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoylamino]propanoate.
| Compound Name | ethyl 3-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 22211098 |
| Molecular Formula | C20H27ClN2O7 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | ethyl 3-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoylamino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)Nc1ccc(Cl)cc1)[C@@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C20H27ClN2O7/c1-5-27-14(24)10-13(23-19(25)22-12-8-6-11(21)7-9-12)15-16(26-4)17-18(28-15)30-20(2,3)29-17/h6-9,13,15-18H,5,10H2,1-4H3,(H2,22,23,25)/t13?,15-,16-,17+,18+/m0/s1 |
| InChIKey | MNDDHSNQRVMDTD-XULKFVHSSA-N |
| XLogP | 2.67 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |