C16H20O6 — CID 20848805
[(5R,6S,6aR)-5-ethyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzenecarboperoxoate (PubChem CID 20848805) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is [(5R,6S,6aR)-5-ethyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzenecarboperoxoate.
| Compound Name | [(5R,6S,6aR)-5-ethyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzenecarboperoxoate |
|---|---|
| PubChem CID | 20848805 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [(5R,6S,6aR)-5-ethyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] benzenecarboperoxoate |
| SMILES | CC[C@H]1OC2OC(C)(C)O[C@@H]2[C@H]1OOC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O6/c1-4-11-12(13-15(18-11)20-16(2,3)19-13)21-22-14(17)10-8-6-5-7-9-10/h5-9,11-13,15H,4H2,1-3H3/t11-,12+,13-,15?/m1/s1 |
| InChIKey | OFRKTKVUIFDRIM-WORDMNGFSA-N |
| XLogP | 2.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|