C18H22O8 — CID 59620985
[(3aR,5R,6S,6aR)-5-(methoxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] phenacyl carbonate (PubChem CID 59620985) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-(methoxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] phenacyl carbonate.
| Compound Name | [(3aR,5R,6S,6aR)-5-(methoxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] phenacyl carbonate |
|---|---|
| PubChem CID | 59620985 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-(methoxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] phenacyl carbonate |
| SMILES | COC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22O8/c1-18(2)25-15-14(13(10-21-3)23-16(15)26-18)24-17(20)22-9-12(19)11-7-5-4-6-8-11/h4-8,13-16H,9-10H2,1-3H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | LWFPCLKWIHRVRS-QKPAOTATSA-N |
| XLogP | 1.91 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |