C26H39NO5 — CID 122202441
benzyl N-[(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(Z)-undec-1-enyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate (PubChem CID 122202441) has the molecular formula C26H39NO5 and a molecular weight of 445.60 g/mol. Its IUPAC name is benzyl N-[(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(Z)-undec-1-enyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate.
| Compound Name | benzyl N-[(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(Z)-undec-1-enyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate |
|---|---|
| PubChem CID | 122202441 |
| Molecular Formula | C26H39NO5 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | benzyl N-[(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(Z)-undec-1-enyl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]carbamate |
| SMILES | CCCCCCCCC/C=C\[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H39NO5/c1-4-5-6-7-8-9-10-11-15-18-21-22(23-24(30-21)32-26(2,3)31-23)27-25(28)29-19-20-16-13-12-14-17-20/h12-18,21-24H,4-11,19H2,1-3H3,(H,27,28)/b18-15-/t21-,22+,23-,24-/m1/s1 |
| InChIKey | UPFZESWNIGUHSG-IHNZWYQQSA-N |
| XLogP | 5.85 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|