C26H30N2O7 — CID 177448010
benzyl N-[(Z)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-(phenylmethoxycarbonylamino)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]carbamate (PubChem CID 177448010) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is benzyl N-[(Z)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-(phenylmethoxycarbonylamino)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]carbamate.
| Compound Name | benzyl N-[(Z)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-(phenylmethoxycarbonylamino)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 177448010 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | benzyl N-[(Z)-3-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-(phenylmethoxycarbonylamino)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]carbamate |
| SMILES | CC1(C)O[C@H]2O[C@H](/C=C\CNC(=O)OCc3ccccc3)[C@H](NC(=O)OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C26H30N2O7/c1-26(2)34-22-21(28-25(30)32-17-19-12-7-4-8-13-19)20(33-23(22)35-26)14-9-15-27-24(29)31-16-18-10-5-3-6-11-18/h3-14,20-23H,15-17H2,1-2H3,(H,27,29)(H,28,30)/b14-9-/t20-,21+,22-,23-/m1/s1 |
| InChIKey | HSFNYPGXAXXZNO-NIJJQSDJSA-N |
| XLogP | 3.64 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|