C28H44N2O7 — CID 508345
ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl(heptyl)amino]propanoate (PubChem CID 508345) has the molecular formula C28H44N2O7 and a molecular weight of 520.67 g/mol. Its IUPAC name is ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl(heptyl)amino]propanoate.
| Compound Name | ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl(heptyl)amino]propanoate |
|---|---|
| PubChem CID | 508345 |
| Molecular Formula | C28H44N2O7 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl(heptyl)amino]propanoate |
| SMILES | CCCCCCCN(C(=O)NCc1ccccc1)[C@@H](CC(=O)OCC)C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C28H44N2O7/c1-6-8-9-10-14-17-30(27(32)29-19-20-15-12-11-13-16-20)21(18-22(31)34-7-2)23-24(33-5)25-26(35-23)37-28(3,4)36-25/h11-13,15-16,21,23-26H,6-10,14,17-19H2,1-5H3,(H,29,32)/t21-,23?,24-,25+,26+/m0/s1 |
| InChIKey | NNISZCBKRHTXSI-VARAPWLTSA-N |
| XLogP | 4.38 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|