C26H38N2O6 — CID 508363
(6S)-3-benzyl-1-heptyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione (PubChem CID 508363) has the molecular formula C26H38N2O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is (6S)-3-benzyl-1-heptyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-3-benzyl-1-heptyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 508363 |
| Molecular Formula | C26H38N2O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | (6S)-3-benzyl-1-heptyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
| SMILES | CCCCCCCN1C(=O)N(Cc2ccccc2)C(=O)C[C@H]1C1OC2OC(C)(C)OC2[C@H]1OC |
| InChI | InChI=1S/C26H38N2O6/c1-5-6-7-8-12-15-27-19(21-22(31-4)23-24(32-21)34-26(2,3)33-23)16-20(29)28(25(27)30)17-18-13-10-9-11-14-18/h9-11,13-14,19,21-24H,5-8,12,15-17H2,1-4H3/t19-,21?,22-,23?,24?/m0/s1 |
| InChIKey | LVSDCVDQZOLROB-FKJUHHTKSA-N |
| XLogP | 4.07 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|