C22H29FN2O6 — CID 508362
(6S)-1-butyl-3-(4-fluorophenyl)-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione (PubChem CID 508362) has the molecular formula C22H29FN2O6 and a molecular weight of 436.48 g/mol. Its IUPAC name is (6S)-1-butyl-3-(4-fluorophenyl)-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-1-butyl-3-(4-fluorophenyl)-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 508362 |
| Molecular Formula | C22H29FN2O6 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (6S)-1-butyl-3-(4-fluorophenyl)-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
| SMILES | CCCCN1C(=O)N(c2ccc(F)cc2)C(=O)C[C@H]1C1OC2OC(C)(C)OC2[C@H]1OC |
| InChI | InChI=1S/C22H29FN2O6/c1-5-6-11-24-15(17-18(28-4)19-20(29-17)31-22(2,3)30-19)12-16(26)25(21(24)27)14-9-7-13(23)8-10-14/h7-10,15,17-20H,5-6,11-12H2,1-4H3/t15-,17?,18-,19?,20?/m0/s1 |
| InChIKey | GSNRAVINPOOLLV-GGDKKLJYSA-N |
| XLogP | 3.04 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |