C24H35FN2O7 — CID 508344
ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[butyl-[(4-fluorophenyl)carbamoyl]amino]propanoate (PubChem CID 508344) has the molecular formula C24H35FN2O7 and a molecular weight of 482.55 g/mol. Its IUPAC name is ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[butyl-[(4-fluorophenyl)carbamoyl]amino]propanoate.
| Compound Name | ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[butyl-[(4-fluorophenyl)carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 508344 |
| Molecular Formula | C24H35FN2O7 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[butyl-[(4-fluorophenyl)carbamoyl]amino]propanoate |
| SMILES | CCCCN(C(=O)Nc1ccc(F)cc1)[C@@H](CC(=O)OCC)C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C24H35FN2O7/c1-6-8-13-27(23(29)26-16-11-9-15(25)10-12-16)17(14-18(28)31-7-2)19-20(30-5)21-22(32-19)34-24(3,4)33-21/h9-12,17,19-22H,6-8,13-14H2,1-5H3,(H,26,29)/t17-,19?,20-,21+,22+/m0/s1 |
| InChIKey | BRSWUWHPZJXJBI-OGAVPMENSA-N |
| XLogP | 3.67 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |