C23H31ClN2O7 — CID 508342
ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoyl-cyclopropylamino]propanoate (PubChem CID 508342) has the molecular formula C23H31ClN2O7 and a molecular weight of 482.96 g/mol. Its IUPAC name is ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoyl-cyclopropylamino]propanoate.
| Compound Name | ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoyl-cyclopropylamino]propanoate |
|---|---|
| PubChem CID | 508342 |
| Molecular Formula | C23H31ClN2O7 |
| Molecular Weight | 482.96 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | ethyl (3S)-3-[(3aR,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoyl-cyclopropylamino]propanoate |
| SMILES | CCOC(=O)C[C@@H](C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC)N(C(=O)Nc1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C23H31ClN2O7/c1-5-30-17(27)12-16(18-19(29-4)20-21(31-18)33-23(2,3)32-20)26(15-10-11-15)22(28)25-14-8-6-13(24)7-9-14/h6-9,15-16,18-21H,5,10-12H2,1-4H3,(H,25,28)/t16-,18?,19-,20+,21+/m0/s1 |
| InChIKey | YAFQIUOHLPQTTH-KXEVLKFVSA-N |
| XLogP | 3.55 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.96 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |