C21H25ClN2O6 — CID 508360
(6S)-3-(4-chlorophenyl)-1-cyclopropyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione (PubChem CID 508360) has the molecular formula C21H25ClN2O6 and a molecular weight of 436.89 g/mol. Its IUPAC name is (6S)-3-(4-chlorophenyl)-1-cyclopropyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-3-(4-chlorophenyl)-1-cyclopropyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 508360 |
| Molecular Formula | C21H25ClN2O6 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (6S)-3-(4-chlorophenyl)-1-cyclopropyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
| SMILES | CO[C@@H]1C2OC(C)(C)OC2OC1[C@@H]1CC(=O)N(c2ccc(Cl)cc2)C(=O)N1C1CC1 |
| InChI | InChI=1S/C21H25ClN2O6/c1-21(2)29-18-17(27-3)16(28-19(18)30-21)14-10-15(25)24(13-6-4-11(22)5-7-13)20(26)23(14)12-8-9-12/h4-7,12,14,16-19H,8-10H2,1-3H3/t14-,16?,17-,18?,19?/m0/s1 |
| InChIKey | YGLVRHSTCIEETP-QHPAWHGXSA-N |
| XLogP | 2.92 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |