C26H27ClN2O6 — CID 508369
(6S)-3-(4-chlorophenyl)-1-cyclopropyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione (PubChem CID 508369) has the molecular formula C26H27ClN2O6 and a molecular weight of 498.96 g/mol. Its IUPAC name is (6S)-3-(4-chlorophenyl)-1-cyclopropyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-3-(4-chlorophenyl)-1-cyclopropyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 508369 |
| Molecular Formula | C26H27ClN2O6 |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (6S)-3-(4-chlorophenyl)-1-cyclopropyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
| SMILES | CC1(C)OC2OC([C@@H]3CC(=O)N(c4ccc(Cl)cc4)C(=O)N3C3CC3)[C@H](Oc3ccccc3)C2O1 |
| InChI | InChI=1S/C26H27ClN2O6/c1-26(2)34-23-22(32-18-6-4-3-5-7-18)21(33-24(23)35-26)19-14-20(30)29(17-10-8-15(27)9-11-17)25(31)28(19)16-12-13-16/h3-11,16,19,21-24H,12-14H2,1-2H3/t19-,21?,22-,23?,24?/m0/s1 |
| InChIKey | FSFPHRWFYCPHGM-FKJUHHTKSA-N |
| XLogP | 4.35 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |