C28H33ClN2O7 — CID 508352
ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoyl-cyclopropylamino]propanoate (PubChem CID 508352) has the molecular formula C28H33ClN2O7 and a molecular weight of 545.03 g/mol. Its IUPAC name is ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoyl-cyclopropylamino]propanoate.
| Compound Name | ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoyl-cyclopropylamino]propanoate |
|---|---|
| PubChem CID | 508352 |
| Molecular Formula | C28H33ClN2O7 |
| Molecular Weight | 545.03 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoyl-cyclopropylamino]propanoate |
| SMILES | CCOC(=O)C[C@@H](C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1Oc1ccccc1)N(C(=O)Nc1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C28H33ClN2O7/c1-4-34-22(32)16-21(31(19-14-15-19)27(33)30-18-12-10-17(29)11-13-18)23-24(35-20-8-6-5-7-9-20)25-26(36-23)38-28(2,3)37-25/h5-13,19,21,23-26H,4,14-16H2,1-3H3,(H,30,33)/t21-,23?,24-,25+,26+/m0/s1 |
| InChIKey | YWQZBMCTVXGMMS-VARAPWLTSA-N |
| XLogP | 4.98 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.03 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |