C33H37ClN2O7 — CID 24825642
ethyl 3-[(3aS,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzyl-[(4-chlorophenyl)carbamoyl]amino]propanoate (PubChem CID 24825642) has the molecular formula C33H37ClN2O7 and a molecular weight of 609.12 g/mol. Its IUPAC name is ethyl 3-[(3aS,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzyl-[(4-chlorophenyl)carbamoyl]amino]propanoate.
| Compound Name | ethyl 3-[(3aS,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzyl-[(4-chlorophenyl)carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 24825642 |
| Molecular Formula | C33H37ClN2O7 |
| Molecular Weight | 609.12 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | ethyl 3-[(3aS,6R,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzyl-[(4-chlorophenyl)carbamoyl]amino]propanoate |
| SMILES | CCOC(=O)CC(C1O[C@H]2OC(C)(C)O[C@H]2[C@@H]1OCc1ccccc1)N(Cc1ccccc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H37ClN2O7/c1-4-39-27(37)19-26(36(20-22-11-7-5-8-12-22)32(38)35-25-17-15-24(34)16-18-25)28-29(40-21-23-13-9-6-10-14-23)30-31(41-28)43-33(2,3)42-30/h5-18,26,28-31H,4,19-21H2,1-3H3,(H,35,38)/t26?,28?,29-,30+,31+/m1/s1 |
| InChIKey | GYBYBJSCUCTPDL-WXVDCZAISA-N |
| XLogP | 6.16 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.12 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |