C25H29ClN2O7 — CID 508350
ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoylamino]propanoate (PubChem CID 508350) has the molecular formula C25H29ClN2O7 and a molecular weight of 504.97 g/mol. Its IUPAC name is ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoylamino]propanoate.
| Compound Name | ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 508350 |
| Molecular Formula | C25H29ClN2O7 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[(4-chlorophenyl)carbamoylamino]propanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)Nc1ccc(Cl)cc1)C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1Oc1ccccc1 |
| InChI | InChI=1S/C25H29ClN2O7/c1-4-31-19(29)14-18(28-24(30)27-16-12-10-15(26)11-13-16)20-21(32-17-8-6-5-7-9-17)22-23(33-20)35-25(2,3)34-22/h5-13,18,20-23H,4,14H2,1-3H3,(H2,27,28,30)/t18-,20?,21-,22+,23+/m0/s1 |
| InChIKey | UXSRWWPAMXVZPE-XKYYZAJSSA-N |
| XLogP | 4.11 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |