C23H23ClN2O6 — CID 508367
(6S)-3-(4-chlorophenyl)-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione (PubChem CID 508367) has the molecular formula C23H23ClN2O6 and a molecular weight of 458.90 g/mol. Its IUPAC name is (6S)-3-(4-chlorophenyl)-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-3-(4-chlorophenyl)-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 508367 |
| Molecular Formula | C23H23ClN2O6 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | (6S)-3-(4-chlorophenyl)-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
| SMILES | CC1(C)OC2OC([C@@H]3CC(=O)N(c4ccc(Cl)cc4)C(=O)N3)[C@H](Oc3ccccc3)C2O1 |
| InChI | InChI=1S/C23H23ClN2O6/c1-23(2)31-20-19(29-15-6-4-3-5-7-15)18(30-21(20)32-23)16-12-17(27)26(22(28)25-16)14-10-8-13(24)9-11-14/h3-11,16,18-21H,12H2,1-2H3,(H,25,28)/t16-,18?,19-,20?,21?/m0/s1 |
| InChIKey | YGAQALZHFJDMHQ-JFTNXMGPSA-N |
| XLogP | 3.48 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |