C27H31FN2O6 — CID 508371
(6S)-1-butyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-fluorophenyl)-1,3-diazinane-2,4-dione (PubChem CID 508371) has the molecular formula C27H31FN2O6 and a molecular weight of 498.55 g/mol. Its IUPAC name is (6S)-1-butyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-fluorophenyl)-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-1-butyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-fluorophenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 508371 |
| Molecular Formula | C27H31FN2O6 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (6S)-1-butyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-fluorophenyl)-1,3-diazinane-2,4-dione |
| SMILES | CCCCN1C(=O)N(c2ccc(F)cc2)C(=O)C[C@H]1C1OC2OC(C)(C)OC2[C@H]1Oc1ccccc1 |
| InChI | InChI=1S/C27H31FN2O6/c1-4-5-15-29-20(16-21(31)30(26(29)32)18-13-11-17(28)12-14-18)22-23(33-19-9-7-6-8-10-19)24-25(34-22)36-27(2,3)35-24/h6-14,20,22-25H,4-5,15-16H2,1-3H3/t20-,22?,23-,24?,25?/m0/s1 |
| InChIKey | ODZNGUZYCYAYDI-XSSHQBQMSA-N |
| XLogP | 4.48 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |