C42H60N2O6 — CID 6478715
(6S)-3-benzyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[(Z)-octadec-9-enyl]-1,3-diazinane-2,4-dione (PubChem CID 6478715) has the molecular formula C42H60N2O6 and a molecular weight of 688.95 g/mol. Its IUPAC name is (6S)-3-benzyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[(Z)-octadec-9-enyl]-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-3-benzyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[(Z)-octadec-9-enyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 6478715 |
| Molecular Formula | C42H60N2O6 |
| Molecular Weight | 688.95 g/mol |
| Exact Mass | 688.45 |
| IUPAC Name | (6S)-3-benzyl-6-[(6S)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[(Z)-octadec-9-enyl]-1,3-diazinane-2,4-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN1C(=O)N(Cc2ccccc2)C(=O)C[C@H]1C1OC2OC(C)(C)OC2[C@H]1Oc1ccccc1 |
| InChI | InChI=1S/C42H60N2O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25-30-43-35(31-36(45)44(41(43)46)32-33-26-21-19-22-27-33)37-38(47-34-28-23-20-24-29-34)39-40(48-37)50-42(2,3)49-39/h11-12,19-24,26-29,35,37-40H,4-10,13-18,25,30-32H2,1-3H3/b12-11-/t35-,37?,38-,39?,40?/m0/s1 |
| InChIKey | JQAVMQZMUWOLNL-CVFPLRSISA-N |
| XLogP | 9.57 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.95 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|