C29H36N2O7 — CID 508353
ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl(cyclopropyl)amino]propanoate (PubChem CID 508353) has the molecular formula C29H36N2O7 and a molecular weight of 524.61 g/mol. Its IUPAC name is ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl(cyclopropyl)amino]propanoate.
| Compound Name | ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl(cyclopropyl)amino]propanoate |
|---|---|
| PubChem CID | 508353 |
| Molecular Formula | C29H36N2O7 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl(cyclopropyl)amino]propanoate |
| SMILES | CCOC(=O)C[C@@H](C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1Oc1ccccc1)N(C(=O)NCc1ccccc1)C1CC1 |
| InChI | InChI=1S/C29H36N2O7/c1-4-34-23(32)17-22(31(20-15-16-20)28(33)30-18-19-11-7-5-8-12-19)24-25(35-21-13-9-6-10-14-21)26-27(36-24)38-29(2,3)37-26/h5-14,20,22,24-27H,4,15-18H2,1-3H3,(H,30,33)/t22-,24?,25-,26+,27+/m0/s1 |
| InChIKey | MPKMGBIBJJUAJW-LFSLWVPISA-N |
| XLogP | 4.01 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |