C44H66N2O7 — CID 6478713
ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl-[(Z)-octadec-9-enyl]amino]propanoate (PubChem CID 6478713) has the molecular formula C44H66N2O7 and a molecular weight of 735.02 g/mol. Its IUPAC name is ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl-[(Z)-octadec-9-enyl]amino]propanoate.
| Compound Name | ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl-[(Z)-octadec-9-enyl]amino]propanoate |
|---|---|
| PubChem CID | 6478713 |
| Molecular Formula | C44H66N2O7 |
| Molecular Weight | 735.02 g/mol |
| Exact Mass | 734.49 |
| IUPAC Name | ethyl (3S)-3-[(3aR,6S,6aR)-2,2-dimethyl-6-phenoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-[benzylcarbamoyl-[(Z)-octadec-9-enyl]amino]propanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(C(=O)NCc1ccccc1)[C@@H](CC(=O)OCC)C1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1Oc1ccccc1 |
| InChI | InChI=1S/C44H66N2O7/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-27-32-46(43(48)45-34-35-28-23-21-24-29-35)37(33-38(47)49-6-2)39-40(50-36-30-25-22-26-31-36)41-42(51-39)53-44(3,4)52-41/h13-14,21-26,28-31,37,39-42H,5-12,15-20,27,32-34H2,1-4H3,(H,45,48)/b14-13-/t37-,39?,40-,41+,42+/m0/s1 |
| InChIKey | PLHNMQKKKCXVPG-QNKMLJAZSA-N |
| XLogP | 9.88 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.02 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|