C36H56N2O6 — CID 6478714
(6S)-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[(Z)-octadec-9-enyl]-3-phenyl-1,3-diazinane-2,4-dione (PubChem CID 6478714) has the molecular formula C36H56N2O6 and a molecular weight of 612.85 g/mol. Its IUPAC name is (6S)-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[(Z)-octadec-9-enyl]-3-phenyl-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[(Z)-octadec-9-enyl]-3-phenyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 6478714 |
| Molecular Formula | C36H56N2O6 |
| Molecular Weight | 612.85 g/mol |
| Exact Mass | 612.41 |
| IUPAC Name | (6S)-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1-[(Z)-octadec-9-enyl]-3-phenyl-1,3-diazinane-2,4-dione |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN1C(=O)N(c2ccccc2)C(=O)C[C@H]1C1OC2OC(C)(C)OC2[C@H]1OC |
| InChI | InChI=1S/C36H56N2O6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-26-37-29(27-30(39)38(35(37)40)28-24-21-20-22-25-28)31-32(41-4)33-34(42-31)44-36(2,3)43-33/h12-13,20-22,24-25,29,31-34H,5-11,14-19,23,26-27H2,1-4H3/b13-12-/t29-,31?,32-,33?,34?/m0/s1 |
| InChIKey | XLNFEQQFAXTTHJ-VKOHTHQQSA-N |
| XLogP | 8.14 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.85 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|