C18H24FNO6 — CID 164671050
ethyl (2R)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(4-fluoroanilino)acetate (PubChem CID 164671050) has the molecular formula C18H24FNO6 and a molecular weight of 369.39 g/mol. Its IUPAC name is ethyl (2R)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(4-fluoroanilino)acetate.
| Compound Name | ethyl (2R)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(4-fluoroanilino)acetate |
|---|---|
| PubChem CID | 164671050 |
| Molecular Formula | C18H24FNO6 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | ethyl (2R)-2-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-(4-fluoroanilino)acetate |
| SMILES | CCOC(=O)[C@H](Nc1ccc(F)cc1)[C@H]1O[C@@H](OC)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H24FNO6/c1-5-23-16(21)12(20-11-8-6-10(19)7-9-11)13-14-15(17(22-4)24-13)26-18(2,3)25-14/h6-9,12-15,17,20H,5H2,1-4H3/t12-,13-,14-,15-,17-/m1/s1 |
| InChIKey | WCGBMYKEZFZQOP-DRXUAVOGSA-N |
| XLogP | 2.06 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |