C35H44FNO19 — CID 164671048
ethyl (2R)-2-(4-fluoroanilino)-2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]acetate (PubChem CID 164671048) has the molecular formula C35H44FNO19 and a molecular weight of 801.72 g/mol. Its IUPAC name is ethyl (2R)-2-(4-fluoroanilino)-2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]acetate.
| Compound Name | ethyl (2R)-2-(4-fluoroanilino)-2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 164671048 |
| Molecular Formula | C35H44FNO19 |
| Molecular Weight | 801.72 g/mol |
| Exact Mass | 801.25 |
| IUPAC Name | ethyl (2R)-2-(4-fluoroanilino)-2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]acetate |
| SMILES | CCOC(=O)[C@H](Nc1ccc(F)cc1)[C@H]1O[C@H](O[C@@H]2O[C@@H](COC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C35H44FNO19/c1-9-46-33(45)25(37-23-12-10-22(36)11-13-23)27-29(50-18(5)41)30(51-19(6)42)32(53-21(8)44)35(55-27)56-34-31(52-20(7)43)28(49-17(4)40)26(48-16(3)39)24(54-34)14-47-15(2)38/h10-13,24-32,34-35,37H,9,14H2,1-8H3/t24-,25+,26-,27+,28+,29+,30-,31-,32+,34-,35+/m0/s1 |
| InChIKey | QOCCBMQXRBKNDN-FTFYHRRFSA-N |
| XLogP | 0.79 |
| TPSA | 250.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.72 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|