C22H28FNO10 — CID 146162255
ethyl 2-(4-fluoroanilino)-2-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]acetate (PubChem CID 146162255) has the molecular formula C22H28FNO10 and a molecular weight of 485.46 g/mol. Its IUPAC name is ethyl 2-(4-fluoroanilino)-2-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]acetate.
| Compound Name | ethyl 2-(4-fluoroanilino)-2-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 146162255 |
| Molecular Formula | C22H28FNO10 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | ethyl 2-(4-fluoroanilino)-2-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]acetate |
| SMILES | CCOC(=O)C(Nc1ccc(F)cc1)[C@H]1O[C@H](OC)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H28FNO10/c1-6-30-21(28)16(24-15-9-7-14(23)8-10-15)17-18(31-11(2)25)19(32-12(3)26)20(33-13(4)27)22(29-5)34-17/h7-10,16-20,22,24H,6H2,1-5H3/t16?,17-,18-,19+,20-,22+/m1/s1 |
| InChIKey | BKLXLLMAJSGRSB-FCKBQJKBSA-N |
| XLogP | 1.34 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|