C21H28FNO7 — CID 164671052
ethyl (2R)-2-(4-fluoroanilino)-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate (PubChem CID 164671052) has the molecular formula C21H28FNO7 and a molecular weight of 425.45 g/mol. Its IUPAC name is ethyl (2R)-2-(4-fluoroanilino)-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate.
| Compound Name | ethyl (2R)-2-(4-fluoroanilino)-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate |
|---|---|
| PubChem CID | 164671052 |
| Molecular Formula | C21H28FNO7 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | ethyl (2R)-2-(4-fluoroanilino)-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate |
| SMILES | CCOC(=O)[C@H](Nc1ccc(F)cc1)[C@@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C21H28FNO7/c1-6-25-18(24)13(23-12-9-7-11(22)8-10-12)14-15-16(28-20(2,3)27-15)17-19(26-14)30-21(4,5)29-17/h7-10,13-17,19,23H,6H2,1-5H3/t13-,14+,15+,16+,17-,19-/m1/s1 |
| InChIKey | PSRZCGBKMIWEIO-CLCAGADWSA-N |
| XLogP | 2.57 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |