C16H17NO9 — CID 11916446
[(2S,3S,4R,5S,6R)-5-anilino-3,4,6-triformyloxyoxan-2-yl]methyl formate (PubChem CID 11916446) has the molecular formula C16H17NO9 and a molecular weight of 367.31 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-5-anilino-3,4,6-triformyloxyoxan-2-yl]methyl formate.
| Compound Name | [(2S,3S,4R,5S,6R)-5-anilino-3,4,6-triformyloxyoxan-2-yl]methyl formate |
|---|---|
| PubChem CID | 11916446 |
| Molecular Formula | C16H17NO9 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-5-anilino-3,4,6-triformyloxyoxan-2-yl]methyl formate |
| SMILES | O=COC[C@@H]1O[C@H](OC=O)[C@@H](Nc2ccccc2)[C@@H](OC=O)[C@@H]1OC=O |
| InChI | InChI=1S/C16H17NO9/c18-7-22-6-12-14(23-8-19)15(24-9-20)13(16(26-12)25-10-21)17-11-4-2-1-3-5-11/h1-5,7-10,12-17H,6H2/t12-,13-,14+,15+,16-/m0/s1 |
| InChIKey | MIWNGHGCKIBEFD-RBZJEDDUSA-N |
| XLogP | -0.38 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|